C10H19N3O — CID 79505752
5-cyclopropyl-1-(2-methoxyethyl)-5-methyl-4H-imidazol-2-amine (PubChem CID 79505752) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 5-cyclopropyl-1-(2-methoxyethyl)-5-methyl-4H-imidazol-2-amine.
| Compound Name | 5-cyclopropyl-1-(2-methoxyethyl)-5-methyl-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 79505752 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 5-cyclopropyl-1-(2-methoxyethyl)-5-methyl-4H-imidazol-2-amine |
| SMILES | COCCN1C(N)=NCC1(C)C1CC1 |
| InChI | InChI=1S/C10H19N3O/c1-10(8-3-4-8)7-12-9(11)13(10)5-6-14-2/h8H,3-7H2,1-2H3,(H2,11,12) |
| InChIKey | LESDKNVQHQXQJO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |