C15H18N4O — CID 79505077
1-(2-methoxyethyl)-5-quinolin-8-yl-4,5-dihydroimidazol-2-amine (PubChem CID 79505077) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5-quinolin-8-yl-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-(2-methoxyethyl)-5-quinolin-8-yl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79505077 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-(2-methoxyethyl)-5-quinolin-8-yl-4,5-dihydroimidazol-2-amine |
| SMILES | COCCN1C(N)=NCC1c1cccc2cccnc12 |
| InChI | InChI=1S/C15H18N4O/c1-20-9-8-19-13(10-18-15(19)16)12-6-2-4-11-5-3-7-17-14(11)12/h2-7,13H,8-10H2,1H3,(H2,16,18) |
| InChIKey | WVNIRYMHASYSFA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |