C15H20ClN3 — CID 79505132
1-(3-chlorophenyl)-6-methyl-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 79505132) has the molecular formula C15H20ClN3 and a molecular weight of 277.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-6-methyl-1,3-diazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 1-(3-chlorophenyl)-6-methyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 79505132 |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-(3-chlorophenyl)-6-methyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CC1CCCCC12CN=C(N)N2c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3/c1-11-5-2-3-8-15(11)10-18-14(17)19(15)13-7-4-6-12(16)9-13/h4,6-7,9,11H,2-3,5,8,10H2,1H3,(H2,17,18) |
| InChIKey | SVFRSTGKRDLEIU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |