C8H7F2N5 — CID 79506611
1-[(2,4-difluorophenyl)methyl]tetrazol-5-amine (PubChem CID 79506611) has the molecular formula C8H7F2N5 and a molecular weight of 211.18 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]tetrazol-5-amine.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 79506611 |
| Molecular Formula | C8H7F2N5 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]tetrazol-5-amine |
| SMILES | Nc1nnnn1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C8H7F2N5/c9-6-2-1-5(7(10)3-6)4-15-8(11)12-13-14-15/h1-3H,4H2,(H2,11,12,14) |
| InChIKey | APRZMFBIPNLVSN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |