C19H26N2O3S — CID 7950871
[(1R)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] 3,3-dimethylbutanoate (PubChem CID 7950871) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is [(1R)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] 3,3-dimethylbutanoate.
| Compound Name | [(1R)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 7950871 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(1R)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] 3,3-dimethylbutanoate |
| SMILES | C[C@@H]1CCc2c(sc3nc([C@@H](C)OC(=O)CC(C)(C)C)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C19H26N2O3S/c1-10-6-7-12-13(8-10)25-18-15(12)17(23)20-16(21-18)11(2)24-14(22)9-19(3,4)5/h10-11H,6-9H2,1-5H3,(H,20,21,23)/t10-,11-/m1/s1 |
| InChIKey | ZUIOWPASCKQZAP-GHMZBOCLSA-N |
| XLogP | 4.15 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |