C18H22N2O3S — CID 11919558
cis-[(1R)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate (PubChem CID 11919558) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is cis-[(1R)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate.
| Compound Name | cis-[(1R)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11919558 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | cis-[(1R)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] (1R,2S)-2-methylcyclopropane-1-carboxylate |
| SMILES | C[C@@H]1CCc2c(sc3nc([C@@H](C)OC(=O)[C@@H]4C[C@@H]4C)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C18H22N2O3S/c1-8-4-5-11-13(6-8)24-17-14(11)16(21)19-15(20-17)10(3)23-18(22)12-7-9(12)2/h8-10,12H,4-7H2,1-3H3,(H,19,20,21)/t8-,9+,10-,12-/m1/s1 |
| InChIKey | VXUYVRAIMQZJKX-DTHBNOIPSA-N |
| XLogP | 3.37 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |