C20H19N3O5S — CID 7766370
[(1R)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] 4-nitrobenzoate (PubChem CID 7766370) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is [(1R)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] 4-nitrobenzoate.
| Compound Name | [(1R)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 7766370 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [(1R)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] 4-nitrobenzoate |
| SMILES | C[C@@H]1CCc2c(sc3nc([C@@H](C)OC(=O)c4ccc([N+](=O)[O-])cc4)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C20H19N3O5S/c1-10-3-8-14-15(9-10)29-19-16(14)18(24)21-17(22-19)11(2)28-20(25)12-4-6-13(7-5-12)23(26)27/h4-7,10-11H,3,8-9H2,1-2H3,(H,21,22,24)/t10-,11-/m1/s1 |
| InChIKey | IJMCKEFTZAOOKC-GHMZBOCLSA-N |
| XLogP | 3.94 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|