C18H17N3O6S — CID 9144324
[(1S)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] 5-nitrofuran-2-carboxylate (PubChem CID 9144324) has the molecular formula C18H17N3O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is [(1S)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [(1S)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 9144324 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | [(1S)-1-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]ethyl] 5-nitrofuran-2-carboxylate |
| SMILES | C[C@@H]1CCc2c(sc3nc([C@H](C)OC(=O)c4ccc([N+](=O)[O-])o4)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C18H17N3O6S/c1-8-3-4-10-12(7-8)28-17-14(10)16(22)19-15(20-17)9(2)26-18(23)11-5-6-13(27-11)21(24)25/h5-6,8-9H,3-4,7H2,1-2H3,(H,19,20,22)/t8-,9+/m1/s1 |
| InChIKey | SWFBQQSGKUVXIP-BDAKNGLRSA-N |
| XLogP | 3.53 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|