C14H21N3O — CID 79514423
5-tert-butyl-1-(2-methoxyphenyl)-4,5-dihydroimidazol-2-amine (PubChem CID 79514423) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 5-tert-butyl-1-(2-methoxyphenyl)-4,5-dihydroimidazol-2-amine.
| Compound Name | 5-tert-butyl-1-(2-methoxyphenyl)-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79514423 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 5-tert-butyl-1-(2-methoxyphenyl)-4,5-dihydroimidazol-2-amine |
| SMILES | COc1ccccc1N1C(N)=NCC1C(C)(C)C |
| InChI | InChI=1S/C14H21N3O/c1-14(2,3)12-9-16-13(15)17(12)10-7-5-6-8-11(10)18-4/h5-8,12H,9H2,1-4H3,(H2,15,16) |
| InChIKey | AUXDYWQXROJZJL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |