C13H19N3O — CID 79514424
1-(2-methoxyphenyl)-5-propyl-4,5-dihydroimidazol-2-amine (PubChem CID 79514424) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-5-propyl-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-(2-methoxyphenyl)-5-propyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79514424 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1-(2-methoxyphenyl)-5-propyl-4,5-dihydroimidazol-2-amine |
| SMILES | CCCC1CN=C(N)N1c1ccccc1OC |
| InChI | InChI=1S/C13H19N3O/c1-3-6-10-9-15-13(14)16(10)11-7-4-5-8-12(11)17-2/h4-5,7-8,10H,3,6,9H2,1-2H3,(H2,14,15) |
| InChIKey | XDYBYFAUDGFOPB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |