C13H17BrN2O5 — CID 79515242
5-bromo-N-[2-[(4-hydroxyoxan-4-yl)methylamino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 79515242) has the molecular formula C13H17BrN2O5 and a molecular weight of 361.19 g/mol. Its IUPAC name is 5-bromo-N-[2-[(4-hydroxyoxan-4-yl)methylamino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[(4-hydroxyoxan-4-yl)methylamino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 79515242 |
| Molecular Formula | C13H17BrN2O5 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 5-bromo-N-[2-[(4-hydroxyoxan-4-yl)methylamino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)o1)NCC1(O)CCOCC1 |
| InChI | InChI=1S/C13H17BrN2O5/c14-10-2-1-9(21-10)12(18)15-7-11(17)16-8-13(19)3-5-20-6-4-13/h1-2,19H,3-8H2,(H,15,18)(H,16,17) |
| InChIKey | VVVYSTOSLWWYSS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |