C8H13NO2S — CID 79517091
1-(3-methylsulfanylpropyl)pyrrolidine-2,4-dione (PubChem CID 79517091) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)pyrrolidine-2,4-dione.
| Compound Name | 1-(3-methylsulfanylpropyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 79517091 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)pyrrolidine-2,4-dione |
| SMILES | CSCCCN1CC(=O)CC1=O |
| InChI | InChI=1S/C8H13NO2S/c1-12-4-2-3-9-6-7(10)5-8(9)11/h2-6H2,1H3 |
| InChIKey | WZSZBDIJFWGREX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|