C11H16BrN3O2 — CID 79523278
1-(3-bromo-5-nitro-2-pyridinyl)-N,3-dimethylbutan-2-amine (PubChem CID 79523278) has the molecular formula C11H16BrN3O2 and a molecular weight of 302.17 g/mol. Its IUPAC name is 1-(3-bromo-5-nitro-2-pyridinyl)-N,3-dimethylbutan-2-amine.
| Compound Name | 1-(3-bromo-5-nitro-2-pyridinyl)-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 79523278 |
| Molecular Formula | C11H16BrN3O2 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 1-(3-bromo-5-nitro-2-pyridinyl)-N,3-dimethylbutan-2-amine |
| SMILES | CNC(Cc1ncc([N+](=O)[O-])cc1Br)C(C)C |
| InChI | InChI=1S/C11H16BrN3O2/c1-7(2)10(13-3)5-11-9(12)4-8(6-14-11)15(16)17/h4,6-7,10,13H,5H2,1-3H3 |
| InChIKey | APFWCQPVXKHEFA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|