C9H17N5O — CID 79523783
1-[(5-amino-1-methylpyrazol-4-yl)methyl]-3-propan-2-ylurea (PubChem CID 79523783) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 1-[(5-amino-1-methylpyrazol-4-yl)methyl]-3-propan-2-ylurea.
| Compound Name | 1-[(5-amino-1-methylpyrazol-4-yl)methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 79523783 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 1-[(5-amino-1-methylpyrazol-4-yl)methyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCc1cnn(C)c1N |
| InChI | InChI=1S/C9H17N5O/c1-6(2)13-9(15)11-4-7-5-12-14(3)8(7)10/h5-6H,4,10H2,1-3H3,(H2,11,13,15) |
| InChIKey | KCEIPXACMZJFEQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |