C10H12N4O2 — CID 79523860
N-[(5-amino-1-methylpyrazol-4-yl)methyl]furan-3-carboxamide (PubChem CID 79523860) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-[(5-amino-1-methylpyrazol-4-yl)methyl]furan-3-carboxamide.
| Compound Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 79523860 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]furan-3-carboxamide |
| SMILES | Cn1ncc(CNC(=O)c2ccoc2)c1N |
| InChI | InChI=1S/C10H12N4O2/c1-14-9(11)8(5-13-14)4-12-10(15)7-2-3-16-6-7/h2-3,5-6H,4,11H2,1H3,(H,12,15) |
| InChIKey | SAXRUDWFDCOQGR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |