C12H13FN4O2 — CID 107015976
N-[(5-amino-1-methylpyrazol-4-yl)methyl]-2-fluoro-6-hydroxybenzamide (PubChem CID 107015976) has the molecular formula C12H13FN4O2 and a molecular weight of 264.26 g/mol. Its IUPAC name is N-[(5-amino-1-methylpyrazol-4-yl)methyl]-2-fluoro-6-hydroxybenzamide.
| Compound Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-2-fluoro-6-hydroxybenzamide |
|---|---|
| PubChem CID | 107015976 |
| Molecular Formula | C12H13FN4O2 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-2-fluoro-6-hydroxybenzamide |
| SMILES | Cn1ncc(CNC(=O)c2c(O)cccc2F)c1N |
| InChI | InChI=1S/C12H13FN4O2/c1-17-11(14)7(6-16-17)5-15-12(19)10-8(13)3-2-4-9(10)18/h2-4,6,18H,5,14H2,1H3,(H,15,19) |
| InChIKey | BAGHLKJVGKBOKS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |