C12H12ClN5O3 — CID 79531423
N-[(5-amino-1-methylpyrazol-4-yl)methyl]-2-chloro-6-nitrobenzamide (PubChem CID 79531423) has the molecular formula C12H12ClN5O3 and a molecular weight of 309.71 g/mol. Its IUPAC name is N-[(5-amino-1-methylpyrazol-4-yl)methyl]-2-chloro-6-nitrobenzamide.
| Compound Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-2-chloro-6-nitrobenzamide |
|---|---|
| PubChem CID | 79531423 |
| Molecular Formula | C12H12ClN5O3 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-2-chloro-6-nitrobenzamide |
| SMILES | Cn1ncc(CNC(=O)c2c(Cl)cccc2[N+](=O)[O-])c1N |
| InChI | InChI=1S/C12H12ClN5O3/c1-17-11(14)7(6-16-17)5-15-12(19)10-8(13)3-2-4-9(10)18(20)21/h2-4,6H,5,14H2,1H3,(H,15,19) |
| InChIKey | NNGXKKJPXVERFB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|