C12H14FN5O — CID 79524482
2-[(5-amino-1-methylpyrazol-4-yl)methylamino]-6-fluorobenzamide (PubChem CID 79524482) has the molecular formula C12H14FN5O and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-[(5-amino-1-methylpyrazol-4-yl)methylamino]-6-fluorobenzamide.
| Compound Name | 2-[(5-amino-1-methylpyrazol-4-yl)methylamino]-6-fluorobenzamide |
|---|---|
| PubChem CID | 79524482 |
| Molecular Formula | C12H14FN5O |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-[(5-amino-1-methylpyrazol-4-yl)methylamino]-6-fluorobenzamide |
| SMILES | Cn1ncc(CNc2cccc(F)c2C(N)=O)c1N |
| InChI | InChI=1S/C12H14FN5O/c1-18-11(14)7(6-17-18)5-16-9-4-2-3-8(13)10(9)12(15)19/h2-4,6,16H,5,14H2,1H3,(H2,15,19) |
| InChIKey | PPXLVZSBKOINML-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |