C11H13N5O2 — CID 79523767
N-[(5-amino-1-methylpyrazol-4-yl)methyl]-3-hydroxypyridine-2-carboxamide (PubChem CID 79523767) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is N-[(5-amino-1-methylpyrazol-4-yl)methyl]-3-hydroxypyridine-2-carboxamide.
| Compound Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-3-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 79523767 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-[(5-amino-1-methylpyrazol-4-yl)methyl]-3-hydroxypyridine-2-carboxamide |
| SMILES | Cn1ncc(CNC(=O)c2ncccc2O)c1N |
| InChI | InChI=1S/C11H13N5O2/c1-16-10(12)7(6-15-16)5-14-11(18)9-8(17)3-2-4-13-9/h2-4,6,17H,5,12H2,1H3,(H,14,18) |
| InChIKey | QWKIZEUKJNHSPE-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |