C22H23NO3S — CID 7953181
[(2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate (PubChem CID 7953181) has the molecular formula C22H23NO3S and a molecular weight of 381.50 g/mol. Its IUPAC name is [(2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7953181 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | [(2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate |
| SMILES | CSc1ccc(/C=C/C(=O)O[C@H](C)C(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C22H23NO3S/c1-16(22(25)23-14-13-18-5-3-4-6-19(18)15-23)26-21(24)12-9-17-7-10-20(27-2)11-8-17/h3-12,16H,13-15H2,1-2H3/b12-9+/t16-/m1/s1 |
| InChIKey | KEPJSMFPRVIFHX-ONOODXEBSA-N |
| XLogP | 3.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|