C20H18N2O3S — CID 7953228
[(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate (PubChem CID 7953228) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7953228 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate |
| SMILES | CSc1ccc(/C=C/C(=O)O[C@H](C)C(=O)Nc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C20H18N2O3S/c1-14(20(24)22-17-8-3-16(13-21)4-9-17)25-19(23)12-7-15-5-10-18(26-2)11-6-15/h3-12,14H,1-2H3,(H,22,24)/b12-7+/t14-/m1/s1 |
| InChIKey | MIKMJAYQENDODO-WEKMIXOTSA-N |
| XLogP | 3.86 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|