C21H21NO4S — CID 7953087
[(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate (PubChem CID 7953087) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7953087 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] (E)-3-(4-methylsulfanylphenyl)prop-2-enoate |
| SMILES | CSc1ccc(/C=C/C(=O)O[C@H](C)C(=O)Nc2cccc(C(C)=O)c2)cc1 |
| InChI | InChI=1S/C21H21NO4S/c1-14(23)17-5-4-6-18(13-17)22-21(25)15(2)26-20(24)12-9-16-7-10-19(27-3)11-8-16/h4-13,15H,1-3H3,(H,22,25)/b12-9+/t15-/m1/s1 |
| InChIKey | REFVAQVLCWADGI-SAAWKEMMSA-N |
| XLogP | 4.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|