C26H25N3O8S2 — CID 98387643
[(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] (E)-3-[4-[(3-sulfamoylphenyl)sulfamoyl]phenyl]prop-2-enoate (PubChem CID 98387643) has the molecular formula C26H25N3O8S2 and a molecular weight of 571.63 g/mol. Its IUPAC name is [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] (E)-3-[4-[(3-sulfamoylphenyl)sulfamoyl]phenyl]prop-2-enoate.
| Compound Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] (E)-3-[4-[(3-sulfamoylphenyl)sulfamoyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 98387643 |
| Molecular Formula | C26H25N3O8S2 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] (E)-3-[4-[(3-sulfamoylphenyl)sulfamoyl]phenyl]prop-2-enoate |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)OC(=O)/C=C/c2ccc(S(=O)(=O)Nc3cccc(S(N)(=O)=O)c3)cc2)c1 |
| InChI | InChI=1S/C26H25N3O8S2/c1-17(30)20-5-3-6-21(15-20)28-26(32)18(2)37-25(31)14-11-19-9-12-23(13-10-19)39(35,36)29-22-7-4-8-24(16-22)38(27,33)34/h3-16,18,29H,1-2H3,(H,28,32)(H2,27,33,34)/b14-11+/t18-/m1/s1 |
| InChIKey | SWOQBPBOBIKERW-GPZRYRNASA-N |
| XLogP | 2.92 |
| TPSA | 178.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|