C18H17NO4S — CID 8648280
[(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 8648280) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is [(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8648280 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | [(2S)-1-(3-acetylanilino)-1-oxopropan-2-yl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | CC(=O)c1cccc(NC(=O)[C@H](C)OC(=O)/C=C/c2cccs2)c1 |
| InChI | InChI=1S/C18H17NO4S/c1-12(20)14-5-3-6-15(11-14)19-18(22)13(2)23-17(21)9-8-16-7-4-10-24-16/h3-11,13H,1-2H3,(H,19,22)/b9-8+/t13-/m0/s1 |
| InChIKey | DTIDQQCSEYUFPP-XEHSLEBBSA-N |
| XLogP | 3.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|