C16H31N3 — CID 79532956
[4-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-ylmethyl)cyclohexyl]methanamine (PubChem CID 79532956) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is [4-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-ylmethyl)cyclohexyl]methanamine.
| Compound Name | [4-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-ylmethyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 79532956 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | [4-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-ylmethyl)cyclohexyl]methanamine |
| SMILES | NCC1CCC(CN2CCCN3CCCC3C2)CC1 |
| InChI | InChI=1S/C16H31N3/c17-11-14-4-6-15(7-5-14)12-18-8-2-10-19-9-1-3-16(19)13-18/h14-16H,1-13,17H2 |
| InChIKey | YLRGQLJYPVPJJF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |