C11H12BrN3OS — CID 79533104
2-(2-amino-5-bromophenyl)sulfanyl-N-(2-cyanoethyl)acetamide (PubChem CID 79533104) has the molecular formula C11H12BrN3OS and a molecular weight of 314.21 g/mol. Its IUPAC name is 2-(2-amino-5-bromophenyl)sulfanyl-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-(2-amino-5-bromophenyl)sulfanyl-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 79533104 |
| Molecular Formula | C11H12BrN3OS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 2-(2-amino-5-bromophenyl)sulfanyl-N-(2-cyanoethyl)acetamide |
| SMILES | N#CCCNC(=O)CSc1cc(Br)ccc1N |
| InChI | InChI=1S/C11H12BrN3OS/c12-8-2-3-9(14)10(6-8)17-7-11(16)15-5-1-4-13/h2-3,6H,1,5,7,14H2,(H,15,16) |
| InChIKey | RLFZZEUNIWZPMW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|