C18H27BrN2 — CID 79536151
N-[1-(2-bromophenyl)ethyl]-2-pyrrolidin-2-ylcyclohexan-1-amine (PubChem CID 79536151) has the molecular formula C18H27BrN2 and a molecular weight of 351.33 g/mol. Its IUPAC name is N-[1-(2-bromophenyl)ethyl]-2-pyrrolidin-2-ylcyclohexan-1-amine.
| Compound Name | N-[1-(2-bromophenyl)ethyl]-2-pyrrolidin-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79536151 |
| Molecular Formula | C18H27BrN2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[1-(2-bromophenyl)ethyl]-2-pyrrolidin-2-ylcyclohexan-1-amine |
| SMILES | CC(NC1CCCCC1C1CCCN1)c1ccccc1Br |
| InChI | InChI=1S/C18H27BrN2/c1-13(14-7-2-4-9-16(14)19)21-18-10-5-3-8-15(18)17-11-6-12-20-17/h2,4,7,9,13,15,17-18,20-21H,3,5-6,8,10-12H2,1H3 |
| InChIKey | SXJUQJMXHCCGEF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |