C13H22N4 — CID 79540310
N-[(5-methylpyrazin-2-yl)methyl]-1-pyrrolidin-2-ylpropan-2-amine (PubChem CID 79540310) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is N-[(5-methylpyrazin-2-yl)methyl]-1-pyrrolidin-2-ylpropan-2-amine.
| Compound Name | N-[(5-methylpyrazin-2-yl)methyl]-1-pyrrolidin-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 79540310 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N-[(5-methylpyrazin-2-yl)methyl]-1-pyrrolidin-2-ylpropan-2-amine |
| SMILES | Cc1cnc(CNC(C)CC2CCCN2)cn1 |
| InChI | InChI=1S/C13H22N4/c1-10(6-12-4-3-5-14-12)15-8-13-9-16-11(2)7-17-13/h7,9-10,12,14-15H,3-6,8H2,1-2H3 |
| InChIKey | RHDRAJCGRBIUOJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |