C11H19N3 — CID 62846047
N-[(5-methylpyrazin-2-yl)methyl]pentan-2-amine (PubChem CID 62846047) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-[(5-methylpyrazin-2-yl)methyl]pentan-2-amine.
| Compound Name | N-[(5-methylpyrazin-2-yl)methyl]pentan-2-amine |
|---|---|
| PubChem CID | 62846047 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-[(5-methylpyrazin-2-yl)methyl]pentan-2-amine |
| SMILES | CCCC(C)NCc1cnc(C)cn1 |
| InChI | InChI=1S/C11H19N3/c1-4-5-9(2)12-7-11-8-13-10(3)6-14-11/h6,8-9,12H,4-5,7H2,1-3H3 |
| InChIKey | RRWCHYCISFDOGP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |