C22H23FN2O4 — CID 7954038
[(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 7954038) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is [(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7954038 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc(F)cc1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H23FN2O4/c1-16(29-21(26)11-4-17-2-5-18(23)6-3-17)22(27)24-19-7-9-20(10-8-19)25-12-14-28-15-13-25/h2-11,16H,12-15H2,1H3,(H,24,27)/b11-4+/t16-/m0/s1 |
| InChIKey | LEKSGRHMSPKCGU-VBGPOXQHSA-N |
| XLogP | 3.25 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|