C10H22N2O2 — CID 79540718
3-(1-pyrrolidin-2-ylpropan-2-ylamino)propane-1,2-diol (PubChem CID 79540718) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-(1-pyrrolidin-2-ylpropan-2-ylamino)propane-1,2-diol.
| Compound Name | 3-(1-pyrrolidin-2-ylpropan-2-ylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 79540718 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 3-(1-pyrrolidin-2-ylpropan-2-ylamino)propane-1,2-diol |
| SMILES | CC(CC1CCCN1)NCC(O)CO |
| InChI | InChI=1S/C10H22N2O2/c1-8(12-6-10(14)7-13)5-9-3-2-4-11-9/h8-14H,2-7H2,1H3 |
| InChIKey | NKMODUBFDSSQPL-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |