C10H16N2O2 — CID 79544313
2-(2-oxocyclopentyl)pyrrolidine-1-carboxamide (PubChem CID 79544313) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-(2-oxocyclopentyl)pyrrolidine-1-carboxamide.
| Compound Name | 2-(2-oxocyclopentyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 79544313 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-(2-oxocyclopentyl)pyrrolidine-1-carboxamide |
| SMILES | NC(=O)N1CCCC1C1CCCC1=O |
| InChI | InChI=1S/C10H16N2O2/c11-10(14)12-6-2-4-8(12)7-3-1-5-9(7)13/h7-8H,1-6H2,(H2,11,14) |
| InChIKey | WFRLHGPITKHLMV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |