About 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine
1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine (PubChem CID 79547581) has the molecular formula C11H15ClN6
and a molecular weight of 266.74 g/mol. Its IUPAC name is 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine.
Molecular Properties
| Compound Name | 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine |
| PubChem CID | 79547581 |
| Molecular Formula | C11H15ClN6 |
| Molecular Weight | 266.74 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine |
| SMILES | Cc1nn(C)c(Cn2nnc(N)c2C2CC2)c1Cl |
| InChI | InChI=1S/C11H15ClN6/c1-6-9(12)8(17(2)15-6)5-18-10(7-3-4-7)11(13)14-16-18/h7H,3-5,13H2,1-2H3 |
| InChIKey | YLEZEVFKGHNZEE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.74 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine?
The IUPAC name of 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine (CID 79547581) is 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine.
What is the SMILES notation for 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine?
The canonical SMILES for 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine is Cc1nn(C)c(Cn2nnc(N)c2C2CC2)c1Cl.
What is the InChIKey of 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine?
The InChIKey is YLEZEVFKGHNZEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN6/c1-6-9(12)8(17(2)15-6)5-18-10(7-3-4-7)11(13)14-16-18/h7H,3-5,13H2,1-2H3.
What are the key properties of 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine?
1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine has a molecular weight of 266.74 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-5-cyclopropyltriazol-4-amine is sourced from PubChem (CID 79547581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).