C11H18N4 — CID 79550838
1-(2-bicyclo[2.2.1]heptanylmethyl)-5-methyltriazol-4-amine (PubChem CID 79550838) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanylmethyl)-5-methyltriazol-4-amine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanylmethyl)-5-methyltriazol-4-amine |
|---|---|
| PubChem CID | 79550838 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanylmethyl)-5-methyltriazol-4-amine |
| SMILES | Cc1c(N)nnn1CC1CC2CCC1C2 |
| InChI | InChI=1S/C11H18N4/c1-7-11(12)13-14-15(7)6-10-5-8-2-3-9(10)4-8/h8-10H,2-6,12H2,1H3 |
| InChIKey | TTYAVMDRNZRVPI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |