C15H18FN5 — CID 63684284
2-[1-(2-bicyclo[2.2.1]heptanylmethyl)tetrazol-5-yl]-4-fluoroaniline (PubChem CID 63684284) has the molecular formula C15H18FN5 and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-[1-(2-bicyclo[2.2.1]heptanylmethyl)tetrazol-5-yl]-4-fluoroaniline.
| Compound Name | 2-[1-(2-bicyclo[2.2.1]heptanylmethyl)tetrazol-5-yl]-4-fluoroaniline |
|---|---|
| PubChem CID | 63684284 |
| Molecular Formula | C15H18FN5 |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[1-(2-bicyclo[2.2.1]heptanylmethyl)tetrazol-5-yl]-4-fluoroaniline |
| SMILES | Nc1ccc(F)cc1-c1nnnn1CC1CC2CCC1C2 |
| InChI | InChI=1S/C15H18FN5/c16-12-3-4-14(17)13(7-12)15-18-19-20-21(15)8-11-6-9-1-2-10(11)5-9/h3-4,7,9-11H,1-2,5-6,8,17H2 |
| InChIKey | UTACIPZAXHTZRH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|