C13H20O5 — CID 79555131
ethyl 1-(cyclopropanecarbonyl)-3,3-dimethoxycyclobutane-1-carboxylate (PubChem CID 79555131) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is ethyl 1-(cyclopropanecarbonyl)-3,3-dimethoxycyclobutane-1-carboxylate.
| Compound Name | ethyl 1-(cyclopropanecarbonyl)-3,3-dimethoxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 79555131 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | ethyl 1-(cyclopropanecarbonyl)-3,3-dimethoxycyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)C2CC2)CC(OC)(OC)C1 |
| InChI | InChI=1S/C13H20O5/c1-4-18-11(15)12(10(14)9-5-6-9)7-13(8-12,16-2)17-3/h9H,4-8H2,1-3H3 |
| InChIKey | DMXSSFSGYMFJDX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|