C17H22O — CID 79558173
2-(2-bicyclo[2.2.1]heptanylmethyl)-1,3-dihydroinden-2-ol (PubChem CID 79558173) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylmethyl)-1,3-dihydroinden-2-ol.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylmethyl)-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 79558173 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylmethyl)-1,3-dihydroinden-2-ol |
| SMILES | OC1(CC2CC3CCC2C3)Cc2ccccc2C1 |
| InChI | InChI=1S/C17H22O/c18-17(9-14-3-1-2-4-15(14)10-17)11-16-8-12-5-6-13(16)7-12/h1-4,12-13,16,18H,5-11H2 |
| InChIKey | GSJHVEHSNHEJMV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |