C17H22FN — CID 79550569
3-(2-bicyclo[2.2.1]heptanylmethyl)-3-(4-fluorophenyl)azetidine (PubChem CID 79550569) has the molecular formula C17H22FN and a molecular weight of 259.37 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanylmethyl)-3-(4-fluorophenyl)azetidine.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanylmethyl)-3-(4-fluorophenyl)azetidine |
|---|---|
| PubChem CID | 79550569 |
| Molecular Formula | C17H22FN |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanylmethyl)-3-(4-fluorophenyl)azetidine |
| SMILES | Fc1ccc(C2(CC3CC4CCC3C4)CNC2)cc1 |
| InChI | InChI=1S/C17H22FN/c18-16-5-3-15(4-6-16)17(10-19-11-17)9-14-8-12-1-2-13(14)7-12/h3-6,12-14,19H,1-2,7-11H2 |
| InChIKey | UOOQQNFRRRNUCN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |