C18H25N — CID 79550208
3-(2-bicyclo[2.2.1]heptanylmethyl)-3-(4-methylphenyl)azetidine (PubChem CID 79550208) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanylmethyl)-3-(4-methylphenyl)azetidine.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanylmethyl)-3-(4-methylphenyl)azetidine |
|---|---|
| PubChem CID | 79550208 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanylmethyl)-3-(4-methylphenyl)azetidine |
| SMILES | Cc1ccc(C2(CC3CC4CCC3C4)CNC2)cc1 |
| InChI | InChI=1S/C18H25N/c1-13-2-6-17(7-3-13)18(11-19-12-18)10-16-9-14-4-5-15(16)8-14/h2-3,6-7,14-16,19H,4-5,8-12H2,1H3 |
| InChIKey | SHPUSQUYPRTFAL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |