C15H19BrO — CID 79559401
2-(2-bicyclo[2.2.1]heptanyl)-1-(3-bromophenyl)ethanol (PubChem CID 79559401) has the molecular formula C15H19BrO and a molecular weight of 295.22 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-(3-bromophenyl)ethanol.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(3-bromophenyl)ethanol |
|---|---|
| PubChem CID | 79559401 |
| Molecular Formula | C15H19BrO |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(3-bromophenyl)ethanol |
| SMILES | OC(CC1CC2CCC1C2)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H19BrO/c16-14-3-1-2-12(8-14)15(17)9-13-7-10-4-5-11(13)6-10/h1-3,8,10-11,13,15,17H,4-7,9H2 |
| InChIKey | DNGLBDAJNXUYAG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |