C12H15BrO — CID 65457872
1-(3-bromophenyl)-2-cyclobutylethanol (PubChem CID 65457872) has the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-cyclobutylethanol.
| Compound Name | 1-(3-bromophenyl)-2-cyclobutylethanol |
|---|---|
| PubChem CID | 65457872 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-(3-bromophenyl)-2-cyclobutylethanol |
| SMILES | OC(CC1CCC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrO/c13-11-6-2-5-10(8-11)12(14)7-9-3-1-4-9/h2,5-6,8-9,12,14H,1,3-4,7H2 |
| InChIKey | DTIVOGRHMLVAMM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |