C10H8F3N — CID 79560002
3,3,3-trifluoro-2-(3-methylphenyl)propanenitrile (PubChem CID 79560002) has the molecular formula C10H8F3N and a molecular weight of 199.17 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(3-methylphenyl)propanenitrile.
| Compound Name | 3,3,3-trifluoro-2-(3-methylphenyl)propanenitrile |
|---|---|
| PubChem CID | 79560002 |
| Molecular Formula | C10H8F3N |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3,3,3-trifluoro-2-(3-methylphenyl)propanenitrile |
| SMILES | Cc1cccc(C(C#N)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F3N/c1-7-3-2-4-8(5-7)9(6-14)10(11,12)13/h2-5,9H,1H3 |
| InChIKey | CNPHYIACSYHXNX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |