C16H30N2O2 — CID 79560458
N-butyl-2-[2-(2-oxopropyl)azepan-1-yl]propanamide (PubChem CID 79560458) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-butyl-2-[2-(2-oxopropyl)azepan-1-yl]propanamide.
| Compound Name | N-butyl-2-[2-(2-oxopropyl)azepan-1-yl]propanamide |
|---|---|
| PubChem CID | 79560458 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | N-butyl-2-[2-(2-oxopropyl)azepan-1-yl]propanamide |
| SMILES | CCCCNC(=O)C(C)N1CCCCCC1CC(C)=O |
| InChI | InChI=1S/C16H30N2O2/c1-4-5-10-17-16(20)14(3)18-11-8-6-7-9-15(18)12-13(2)19/h14-15H,4-12H2,1-3H3,(H,17,20) |
| InChIKey | JGCRBOUZXBGVLM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|