C18H27NO — CID 79560534
1-[1-[(3,4-dimethylphenyl)methyl]azepan-2-yl]propan-2-one (PubChem CID 79560534) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-[1-[(3,4-dimethylphenyl)methyl]azepan-2-yl]propan-2-one.
| Compound Name | 1-[1-[(3,4-dimethylphenyl)methyl]azepan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 79560534 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 1-[1-[(3,4-dimethylphenyl)methyl]azepan-2-yl]propan-2-one |
| SMILES | CC(=O)CC1CCCCCN1Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H27NO/c1-14-8-9-17(11-15(14)2)13-19-10-6-4-5-7-18(19)12-16(3)20/h8-9,11,18H,4-7,10,12-13H2,1-3H3 |
| InChIKey | DUXXKBYLEOXZRP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |