C12H17BrN2O4S — CID 79567907
3-bromo-2-methyl-5-[methyl-[2-(methylamino)ethyl]sulfamoyl]benzoic acid (PubChem CID 79567907) has the molecular formula C12H17BrN2O4S and a molecular weight of 365.25 g/mol. Its IUPAC name is 3-bromo-2-methyl-5-[methyl-[2-(methylamino)ethyl]sulfamoyl]benzoic acid.
| Compound Name | 3-bromo-2-methyl-5-[methyl-[2-(methylamino)ethyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 79567907 |
| Molecular Formula | C12H17BrN2O4S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 3-bromo-2-methyl-5-[methyl-[2-(methylamino)ethyl]sulfamoyl]benzoic acid |
| SMILES | CNCCN(C)S(=O)(=O)c1cc(Br)c(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H17BrN2O4S/c1-8-10(12(16)17)6-9(7-11(8)13)20(18,19)15(3)5-4-14-2/h6-7,14H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | CEEACOMQJYTUOK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |