C13H18BrNO5S — CID 79576127
3-bromo-5-[3-methoxypropyl(methyl)sulfamoyl]-2-methylbenzoic acid (PubChem CID 79576127) has the molecular formula C13H18BrNO5S and a molecular weight of 380.26 g/mol. Its IUPAC name is 3-bromo-5-[3-methoxypropyl(methyl)sulfamoyl]-2-methylbenzoic acid.
| Compound Name | 3-bromo-5-[3-methoxypropyl(methyl)sulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 79576127 |
| Molecular Formula | C13H18BrNO5S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 3-bromo-5-[3-methoxypropyl(methyl)sulfamoyl]-2-methylbenzoic acid |
| SMILES | COCCCN(C)S(=O)(=O)c1cc(Br)c(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H18BrNO5S/c1-9-11(13(16)17)7-10(8-12(9)14)21(18,19)15(2)5-4-6-20-3/h7-8H,4-6H2,1-3H3,(H,16,17) |
| InChIKey | RULZBIKZRVAISN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|