C14H20N2O — CID 79568814
2-[2-[methyl(pyridin-4-ylmethyl)amino]ethyl]cyclopentan-1-one (PubChem CID 79568814) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-[2-[methyl(pyridin-4-ylmethyl)amino]ethyl]cyclopentan-1-one.
| Compound Name | 2-[2-[methyl(pyridin-4-ylmethyl)amino]ethyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 79568814 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-[2-[methyl(pyridin-4-ylmethyl)amino]ethyl]cyclopentan-1-one |
| SMILES | CN(CCC1CCCC1=O)Cc1ccncc1 |
| InChI | InChI=1S/C14H20N2O/c1-16(11-12-5-8-15-9-6-12)10-7-13-3-2-4-14(13)17/h5-6,8-9,13H,2-4,7,10-11H2,1H3 |
| InChIKey | NKWQMOBMEOVVBJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |