C15H21NO — CID 79570431
2-[2-(N,3-dimethylanilino)ethyl]cyclopentan-1-one (PubChem CID 79570431) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-[2-(N,3-dimethylanilino)ethyl]cyclopentan-1-one.
| Compound Name | 2-[2-(N,3-dimethylanilino)ethyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 79570431 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-[2-(N,3-dimethylanilino)ethyl]cyclopentan-1-one |
| SMILES | Cc1cccc(N(C)CCC2CCCC2=O)c1 |
| InChI | InChI=1S/C15H21NO/c1-12-5-3-7-14(11-12)16(2)10-9-13-6-4-8-15(13)17/h3,5,7,11,13H,4,6,8-10H2,1-2H3 |
| InChIKey | CHPIXAUYGDDRCV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |