C15H32N2O3 — CID 79571521
[1-amino-2-[2-[2-methoxyethyl(3-methoxypropyl)amino]ethyl]cyclopentyl]methanol (PubChem CID 79571521) has the molecular formula C15H32N2O3 and a molecular weight of 288.43 g/mol. Its IUPAC name is [1-amino-2-[2-[2-methoxyethyl(3-methoxypropyl)amino]ethyl]cyclopentyl]methanol.
| Compound Name | [1-amino-2-[2-[2-methoxyethyl(3-methoxypropyl)amino]ethyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 79571521 |
| Molecular Formula | C15H32N2O3 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | [1-amino-2-[2-[2-methoxyethyl(3-methoxypropyl)amino]ethyl]cyclopentyl]methanol |
| SMILES | COCCCN(CCOC)CCC1CCCC1(N)CO |
| InChI | InChI=1S/C15H32N2O3/c1-19-11-4-8-17(10-12-20-2)9-6-14-5-3-7-15(14,16)13-18/h14,18H,3-13,16H2,1-2H3 |
| InChIKey | HBXXDHCMUKMJEU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|