C14H28N2O2 — CID 79571590
[1-amino-2-[2-[methyl(oxan-4-yl)amino]ethyl]cyclopentyl]methanol (PubChem CID 79571590) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is [1-amino-2-[2-[methyl(oxan-4-yl)amino]ethyl]cyclopentyl]methanol.
| Compound Name | [1-amino-2-[2-[methyl(oxan-4-yl)amino]ethyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 79571590 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | [1-amino-2-[2-[methyl(oxan-4-yl)amino]ethyl]cyclopentyl]methanol |
| SMILES | CN(CCC1CCCC1(N)CO)C1CCOCC1 |
| InChI | InChI=1S/C14H28N2O2/c1-16(13-5-9-18-10-6-13)8-4-12-3-2-7-14(12,15)11-17/h12-13,17H,2-11,15H2,1H3 |
| InChIKey | FYOOPWYGTOXVJY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |